C13H15ClF2N2O2 — CID 61260908
N-[3-chloro-4-(difluoromethoxy)phenyl]piperidine-3-carboxamide (PubChem CID 61260908) has the molecular formula C13H15ClF2N2O2 and a molecular weight of 304.72 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]piperidine-3-carboxamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 61260908 |
| Molecular Formula | C13H15ClF2N2O2 |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)c(Cl)c1)C1CCCNC1 |
| InChI | InChI=1S/C13H15ClF2N2O2/c14-10-6-9(3-4-11(10)20-13(15)16)18-12(19)8-2-1-5-17-7-8/h3-4,6,8,13,17H,1-2,5,7H2,(H,18,19) |
| InChIKey | DXHCHCZKVFTDCT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |