C18H30N2O2 — CID 83961573
N-(piperidin-3-ylmethyl)-3,4-dipropoxyaniline (PubChem CID 83961573) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-3,4-dipropoxyaniline.
| Compound Name | N-(piperidin-3-ylmethyl)-3,4-dipropoxyaniline |
|---|---|
| PubChem CID | 83961573 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-3,4-dipropoxyaniline |
| SMILES | CCCOc1ccc(NCC2CCCNC2)cc1OCCC |
| InChI | InChI=1S/C18H30N2O2/c1-3-10-21-17-8-7-16(12-18(17)22-11-4-2)20-14-15-6-5-9-19-13-15/h7-8,12,15,19-20H,3-6,9-11,13-14H2,1-2H3 |
| InChIKey | KPJZSZFNYOAKSG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|