C19H28N2O — CID 110011353
[1-[2-(cyclohex-3-en-1-ylmethylamino)phenyl]piperidin-4-yl]methanol (PubChem CID 110011353) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is [1-[2-(cyclohex-3-en-1-ylmethylamino)phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[2-(cyclohex-3-en-1-ylmethylamino)phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 110011353 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | [1-[2-(cyclohex-3-en-1-ylmethylamino)phenyl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2ccccc2NCC2CC=CCC2)CC1 |
| InChI | InChI=1S/C19H28N2O/c22-15-17-10-12-21(13-11-17)19-9-5-4-8-18(19)20-14-16-6-2-1-3-7-16/h1-2,4-5,8-9,16-17,20,22H,3,6-7,10-15H2 |
| InChIKey | WKXBNFNRYGUREF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|