C16H19N3 — CID 43673439
N-(cyclohex-3-en-1-ylmethyl)-2-imidazol-1-ylaniline (PubChem CID 43673439) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2-imidazol-1-ylaniline.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2-imidazol-1-ylaniline |
|---|---|
| PubChem CID | 43673439 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2-imidazol-1-ylaniline |
| SMILES | C1=CCC(CNc2ccccc2-n2ccnc2)CC1 |
| InChI | InChI=1S/C16H19N3/c1-2-6-14(7-3-1)12-18-15-8-4-5-9-16(15)19-11-10-17-13-19/h1-2,4-5,8-11,13-14,18H,3,6-7,12H2 |
| InChIKey | WADOPRKTERMIRX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|