C13H15Br2N — CID 107597677
2,6-dibromo-N-(cyclohex-3-en-1-ylmethyl)aniline (PubChem CID 107597677) has the molecular formula C13H15Br2N and a molecular weight of 345.08 g/mol. Its IUPAC name is 2,6-dibromo-N-(cyclohex-3-en-1-ylmethyl)aniline.
| Compound Name | 2,6-dibromo-N-(cyclohex-3-en-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 107597677 |
| Molecular Formula | C13H15Br2N |
| Molecular Weight | 345.08 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 2,6-dibromo-N-(cyclohex-3-en-1-ylmethyl)aniline |
| SMILES | Brc1cccc(Br)c1NCC1CC=CCC1 |
| InChI | InChI=1S/C13H15Br2N/c14-11-7-4-8-12(15)13(11)16-9-10-5-2-1-3-6-10/h1-2,4,7-8,10,16H,3,5-6,9H2 |
| InChIKey | YWQXREJWMGQFFS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.08 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|