C14H16N2 — CID 43201265
3-(cyclohex-3-en-1-ylmethylamino)benzonitrile (PubChem CID 43201265) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 3-(cyclohex-3-en-1-ylmethylamino)benzonitrile.
| Compound Name | 3-(cyclohex-3-en-1-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 43201265 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-(cyclohex-3-en-1-ylmethylamino)benzonitrile |
| SMILES | N#Cc1cccc(NCC2CC=CCC2)c1 |
| InChI | InChI=1S/C14H16N2/c15-10-13-7-4-8-14(9-13)16-11-12-5-2-1-3-6-12/h1-2,4,7-9,12,16H,3,5-6,11H2 |
| InChIKey | ONEKIYFJBKSJHN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|