C13H14BrF2N — CID 65470058
4-bromo-N-(cyclohex-3-en-1-ylmethyl)-2,6-difluoroaniline (PubChem CID 65470058) has the molecular formula C13H14BrF2N and a molecular weight of 302.16 g/mol. Its IUPAC name is 4-bromo-N-(cyclohex-3-en-1-ylmethyl)-2,6-difluoroaniline.
| Compound Name | 4-bromo-N-(cyclohex-3-en-1-ylmethyl)-2,6-difluoroaniline |
|---|---|
| PubChem CID | 65470058 |
| Molecular Formula | C13H14BrF2N |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-bromo-N-(cyclohex-3-en-1-ylmethyl)-2,6-difluoroaniline |
| SMILES | Fc1cc(Br)cc(F)c1NCC1CC=CCC1 |
| InChI | InChI=1S/C13H14BrF2N/c14-10-6-11(15)13(12(16)7-10)17-8-9-4-2-1-3-5-9/h1-2,6-7,9,17H,3-5,8H2 |
| InChIKey | LYUNOVPIDDUZEY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|