C13H20N2S — CID 80553558
2-methylsulfanyl-N-(piperidin-3-ylmethyl)aniline (PubChem CID 80553558) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(piperidin-3-ylmethyl)aniline.
| Compound Name | 2-methylsulfanyl-N-(piperidin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 80553558 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-methylsulfanyl-N-(piperidin-3-ylmethyl)aniline |
| SMILES | CSc1ccccc1NCC1CCCNC1 |
| InChI | InChI=1S/C13H20N2S/c1-16-13-7-3-2-6-12(13)15-10-11-5-4-8-14-9-11/h2-3,6-7,11,14-15H,4-5,8-10H2,1H3 |
| InChIKey | WWGJSXYRFVKPME-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |