C16H26ClN3OS — CID 119929541
2-[methyl(piperidin-3-ylmethyl)amino]-N-(2-methylsulfanylphenyl)acetamide;hydrochloride (PubChem CID 119929541) has the molecular formula C16H26ClN3OS and a molecular weight of 343.92 g/mol. Its IUPAC name is 2-[methyl(piperidin-3-ylmethyl)amino]-N-(2-methylsulfanylphenyl)acetamide;hydrochloride.
| Compound Name | 2-[methyl(piperidin-3-ylmethyl)amino]-N-(2-methylsulfanylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119929541 |
| Molecular Formula | C16H26ClN3OS |
| Molecular Weight | 343.92 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[methyl(piperidin-3-ylmethyl)amino]-N-(2-methylsulfanylphenyl)acetamide;hydrochloride |
| SMILES | CSc1ccccc1NC(=O)CN(C)CC1CCCNC1.Cl |
| InChI | InChI=1S/C16H25N3OS.ClH/c1-19(11-13-6-5-9-17-10-13)12-16(20)18-14-7-3-4-8-15(14)21-2;/h3-4,7-8,13,17H,5-6,9-12H2,1-2H3,(H,18,20);1H |
| InChIKey | OBFCVNJHXGQZNC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.92 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |