C14H22O2 — CID 143066004
[2,6-di(propan-2-yl)phenyl]methoxymethanol (PubChem CID 143066004) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]methoxymethanol.
| Compound Name | [2,6-di(propan-2-yl)phenyl]methoxymethanol |
|---|---|
| PubChem CID | 143066004 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]methoxymethanol |
| SMILES | CC(C)c1cccc(C(C)C)c1COCO |
| InChI | InChI=1S/C14H22O2/c1-10(2)12-6-5-7-13(11(3)4)14(12)8-16-9-15/h5-7,10-11,15H,8-9H2,1-4H3 |
| InChIKey | SDJGMZFFNUPWAI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|