C16H24O — CID 170477366
4-[2,6-di(propan-2-yl)phenyl]but-3-en-1-ol (PubChem CID 170477366) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-[2,6-di(propan-2-yl)phenyl]but-3-en-1-ol.
| Compound Name | 4-[2,6-di(propan-2-yl)phenyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 170477366 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-[2,6-di(propan-2-yl)phenyl]but-3-en-1-ol |
| SMILES | CC(C)c1cccc(C(C)C)c1C=CCCO |
| InChI | InChI=1S/C16H24O/c1-12(2)14-9-7-10-15(13(3)4)16(14)8-5-6-11-17/h5,7-10,12-13,17H,6,11H2,1-4H3 |
| InChIKey | CTBMYGXQHUILNL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |