C19H30S — CID 170479325
4-[2,4,6-tri(propan-2-yl)phenyl]but-3-ene-1-thiol (PubChem CID 170479325) has the molecular formula C19H30S and a molecular weight of 290.52 g/mol. Its IUPAC name is 4-[2,4,6-tri(propan-2-yl)phenyl]but-3-ene-1-thiol.
| Compound Name | 4-[2,4,6-tri(propan-2-yl)phenyl]but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170479325 |
| Molecular Formula | C19H30S |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 4-[2,4,6-tri(propan-2-yl)phenyl]but-3-ene-1-thiol |
| SMILES | CC(C)c1cc(C(C)C)c(C=CCCS)c(C(C)C)c1 |
| InChI | InChI=1S/C19H30S/c1-13(2)16-11-18(14(3)4)17(9-7-8-10-20)19(12-16)15(5)6/h7,9,11-15,20H,8,10H2,1-6H3 |
| InChIKey | SFGFRBZEEQTPMF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|