About 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene
2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene (PubChem CID 91017213) has the molecular formula C17H26
and a molecular weight of 230.39 g/mol. Its IUPAC name is 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene.
Analyze 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene?
The IUPAC name of 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene (CID 91017213) is 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene.
What is the SMILES notation for 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene?
The canonical SMILES for 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene is CCC=Cc1c(C(C)C)cc(C)cc1C(C)C.
What is the InChIKey of 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene?
The InChIKey is SCLRALKJDCUBFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26/c1-7-8-9-15-16(12(2)3)10-14(6)11-17(15)13(4)5/h8-13H,7H2,1-6H3.
What are the key properties of 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene?
2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene has a molecular weight of 230.39 g/mol, XLogP of 5.67, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-enyl-5-methyl-1,3-di(propan-2-yl)benzene is sourced from PubChem (CID 91017213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).