2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid

C15H22O2 — CID 137459361

IUPAC2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid
SMILESCc1cc(C(C)C)c(CC(=O)O)c(C(C)C)c1
InChIInChI=1S/C15H22O2/c1-9(2)12-6-11(5)7-13(10(3)4)14(12)8-15(16)17/h6-7,9-10H,8H2,1-5H3,(H,16,17)
InChIKeyJBYFJDCBDGSBDR-UHFFFAOYSA-N
MW234.34 g/mol
LogP3.87
Rot. Bonds4

About 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid

2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid (PubChem CID 137459361) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid.

Molecular Properties

Compound Name2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid
PubChem CID137459361
Molecular FormulaC15H22O2
Molecular Weight234.34 g/mol
Exact Mass234.16
IUPAC Name2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid
SMILESCc1cc(C(C)C)c(CC(=O)O)c(C(C)C)c1
InChIInChI=1S/C15H22O2/c1-9(2)12-6-11(5)7-13(10(3)4)14(12)8-15(16)17/h6-7,9-10H,8H2,1-5H3,(H,16,17)
InChIKeyJBYFJDCBDGSBDR-UHFFFAOYSA-N
XLogP3.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.34
LogP ≤ 53.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid?
The IUPAC name of 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid (CID 137459361) is 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid.
What is the SMILES notation for 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid?
The canonical SMILES for 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid is Cc1cc(C(C)C)c(CC(=O)O)c(C(C)C)c1.
What is the InChIKey of 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid?
The InChIKey is JBYFJDCBDGSBDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-9(2)12-6-11(5)7-13(10(3)4)14(12)8-15(16)17/h6-7,9-10H,8H2,1-5H3,(H,16,17).
What are the key properties of 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid?
2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid has a molecular weight of 234.34 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-2,6-di(propan-2-yl)phenyl]acetic acid is sourced from PubChem (CID 137459361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).