C15H21FO2 — CID 145387602
2-[4-fluoro-3-methyl-2,6-di(propan-2-yl)phenyl]acetic acid (PubChem CID 145387602) has the molecular formula C15H21FO2 and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-[4-fluoro-3-methyl-2,6-di(propan-2-yl)phenyl]acetic acid.
| Compound Name | 2-[4-fluoro-3-methyl-2,6-di(propan-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 145387602 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[4-fluoro-3-methyl-2,6-di(propan-2-yl)phenyl]acetic acid |
| SMILES | Cc1c(F)cc(C(C)C)c(CC(=O)O)c1C(C)C |
| InChI | InChI=1S/C15H21FO2/c1-8(2)11-6-13(16)10(5)15(9(3)4)12(11)7-14(17)18/h6,8-9H,7H2,1-5H3,(H,17,18) |
| InChIKey | OUKIVRLDTBXRMQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |