C17H24FNO2 — CID 142522461
2-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]acetic acid;ethane (PubChem CID 142522461) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]acetic acid;ethane.
| Compound Name | 2-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]acetic acid;ethane |
|---|---|
| PubChem CID | 142522461 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]acetic acid;ethane |
| SMILES | CC.CC(C)c1cc(C#N)c(F)c(C(C)C)c1CC(=O)O |
| InChI | InChI=1S/C15H18FNO2.C2H6/c1-8(2)11-5-10(7-17)15(16)14(9(3)4)12(11)6-13(18)19;1-2/h5,8-9H,6H2,1-4H3,(H,18,19);1-2H3 |
| InChIKey | RQPHCGMNLOMEBC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |