About [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate
[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate (PubChem CID 164927383) has the molecular formula C14H15FN2O
and a molecular weight of 246.28 g/mol. Its IUPAC name is [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate.
Molecular Properties
| Compound Name | [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate |
| PubChem CID | 164927383 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate |
| SMILES | CC(C)c1cc(C#N)c(F)c(C(C)C)c1OC#N |
| InChI | InChI=1S/C14H15FN2O/c1-8(2)11-5-10(6-16)13(15)12(9(3)4)14(11)18-7-17/h5,8-9H,1-4H3 |
| InChIKey | JPKBGHRRKLRYPA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
The IUPAC name of [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate (CID 164927383) is [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate.
What is the SMILES notation for [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
The canonical SMILES for [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate is CC(C)c1cc(C#N)c(F)c(C(C)C)c1OC#N.
What is the InChIKey of [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
The InChIKey is JPKBGHRRKLRYPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN2O/c1-8(2)11-5-10(6-16)13(15)12(9(3)4)14(11)18-7-17/h5,8-9H,1-4H3.
What are the key properties of [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate has a molecular weight of 246.28 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl] cyanate is sourced from PubChem (CID 164927383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).