C25H34F2N2O — CID 161186862
4-fluoro-2,6-di(propan-2-yl)aniline;[4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate (PubChem CID 161186862) has the molecular formula C25H34F2N2O and a molecular weight of 416.56 g/mol. Its IUPAC name is 4-fluoro-2,6-di(propan-2-yl)aniline;[4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate.
| Compound Name | 4-fluoro-2,6-di(propan-2-yl)aniline;[4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate |
|---|---|
| PubChem CID | 161186862 |
| Molecular Formula | C25H34F2N2O |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-fluoro-2,6-di(propan-2-yl)aniline;[4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1N.CC(C)c1cc(F)cc(C(C)C)c1OC#N |
| InChI | InChI=1S/C13H16FNO.C12H18FN/c1-8(2)11-5-10(14)6-12(9(3)4)13(11)16-7-15;1-7(2)10-5-9(13)6-11(8(3)4)12(10)14/h5-6,8-9H,1-4H3;5-8H,14H2,1-4H3 |
| InChIKey | UTESDLBTUOEIST-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|