About 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile
4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile (PubChem CID 163443828) has the molecular formula C26H34BrN3
and a molecular weight of 468.48 g/mol. Its IUPAC name is 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile |
| PubChem CID | 163443828 |
| Molecular Formula | C26H34BrN3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile |
| SMILES | CC(C)c1cc(C#N)cc(C(C)C)c1Br.CC(C)c1cc(C#N)cc(C(C)C)c1N |
| InChI | InChI=1S/C13H16BrN.C13H18N2/c1-8(2)11-5-10(7-15)6-12(9(3)4)13(11)14;1-8(2)11-5-10(7-14)6-12(9(3)4)13(11)15/h5-6,8-9H,1-4H3;5-6,8-9H,15H2,1-4H3 |
| InChIKey | BAUKRDDVMRJPJX-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile?
The IUPAC name of 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile (CID 163443828) is 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile.
What is the SMILES notation for 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile?
The canonical SMILES for 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile is CC(C)c1cc(C#N)cc(C(C)C)c1Br.CC(C)c1cc(C#N)cc(C(C)C)c1N.
What is the InChIKey of 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile?
The InChIKey is BAUKRDDVMRJPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN.C13H18N2/c1-8(2)11-5-10(7-15)6-12(9(3)4)13(11)14;1-8(2)11-5-10(7-14)6-12(9(3)4)13(11)15/h5-6,8-9H,1-4H3;5-6,8-9H,15H2,1-4H3.
What are the key properties of 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile?
4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile has a molecular weight of 468.48 g/mol, XLogP of 7.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-di(propan-2-yl)benzonitrile;4-bromo-3,5-di(propan-2-yl)benzonitrile is sourced from PubChem (CID 163443828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).