C31H41BrN2 — CID 68747983
4-[[4-amino-3,5-di(propan-2-yl)phenyl]-(4-bromophenyl)methyl]-2,6-di(propan-2-yl)aniline (PubChem CID 68747983) has the molecular formula C31H41BrN2 and a molecular weight of 521.59 g/mol. Its IUPAC name is 4-[[4-amino-3,5-di(propan-2-yl)phenyl]-(4-bromophenyl)methyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | 4-[[4-amino-3,5-di(propan-2-yl)phenyl]-(4-bromophenyl)methyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 68747983 |
| Molecular Formula | C31H41BrN2 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 4-[[4-amino-3,5-di(propan-2-yl)phenyl]-(4-bromophenyl)methyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cc(C(c2ccc(Br)cc2)c2cc(C(C)C)c(N)c(C(C)C)c2)cc(C(C)C)c1N |
| InChI | InChI=1S/C31H41BrN2/c1-17(2)25-13-22(14-26(18(3)4)30(25)33)29(21-9-11-24(32)12-10-21)23-15-27(19(5)6)31(34)28(16-23)20(7)8/h9-20,29H,33-34H2,1-8H3 |
| InChIKey | XCAARHOJIKJLNU-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|