C16H27N — CID 58701369
4-butan-2-yl-2,6-di(propan-2-yl)aniline (PubChem CID 58701369) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 4-butan-2-yl-2,6-di(propan-2-yl)aniline.
| Compound Name | 4-butan-2-yl-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 58701369 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 4-butan-2-yl-2,6-di(propan-2-yl)aniline |
| SMILES | CCC(C)c1cc(C(C)C)c(N)c(C(C)C)c1 |
| InChI | InChI=1S/C16H27N/c1-7-12(6)13-8-14(10(2)3)16(17)15(9-13)11(4)5/h8-12H,7,17H2,1-6H3 |
| InChIKey | WYRNKUVPDUMOKN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|