C34H56N2 — CID 151636757
4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]decyl]-2,6-di(propan-2-yl)aniline (PubChem CID 151636757) has the molecular formula C34H56N2 and a molecular weight of 492.84 g/mol. Its IUPAC name is 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]decyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]decyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 151636757 |
| Molecular Formula | C34H56N2 |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 492.44 |
| IUPAC Name | 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]decyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CCCCCCCCCC(c1cc(C(C)C)c(N)c(C(C)C)c1)c1cc(C(C)C)c(N)c(C(C)C)c1 |
| InChI | InChI=1S/C34H56N2/c1-10-11-12-13-14-15-16-17-28(26-18-29(22(2)3)33(35)30(19-26)23(4)5)27-20-31(24(6)7)34(36)32(21-27)25(8)9/h18-25,28H,10-17,35-36H2,1-9H3 |
| InChIKey | QRQXGRMWGXXELM-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|