C34H54O2 — CID 139968357
2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)octyl]-6-propan-2-ylphenol (PubChem CID 139968357) has the molecular formula C34H54O2 and a molecular weight of 494.80 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)octyl]-6-propan-2-ylphenol.
| Compound Name | 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)octyl]-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 139968357 |
| Molecular Formula | C34H54O2 |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)octyl]-6-propan-2-ylphenol |
| SMILES | CCCCCCCC(c1cc(C(C)C)c(O)c(C(C)(C)C)c1)c1cc(C(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H54O2/c1-12-13-14-15-16-17-26(24-18-27(22(2)3)31(35)29(20-24)33(6,7)8)25-19-28(23(4)5)32(36)30(21-25)34(9,10)11/h18-23,26,35-36H,12-17H2,1-11H3 |
| InChIKey | CYNVOBWQGOZDIZ-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|