C24H36N2 — CID 22753054
4-[1-(4-aminophenyl)hexyl]-2,6-dipropylaniline (PubChem CID 22753054) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is 4-[1-(4-aminophenyl)hexyl]-2,6-dipropylaniline.
| Compound Name | 4-[1-(4-aminophenyl)hexyl]-2,6-dipropylaniline |
|---|---|
| PubChem CID | 22753054 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | 4-[1-(4-aminophenyl)hexyl]-2,6-dipropylaniline |
| SMILES | CCCCCC(c1ccc(N)cc1)c1cc(CCC)c(N)c(CCC)c1 |
| InChI | InChI=1S/C24H36N2/c1-4-7-8-11-23(18-12-14-22(25)15-13-18)21-16-19(9-5-2)24(26)20(17-21)10-6-3/h12-17,23H,4-11,25-26H2,1-3H3 |
| InChIKey | AWDBFJGYZLLKPL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|