C30H44N2O2 — CID 137160061
4-butan-2-yl-2-[2-[(5-butan-2-yl-2-hydroxy-3-propan-2-ylphenyl)methylideneamino]ethyliminomethyl]-6-propan-2-ylphenol (PubChem CID 137160061) has the molecular formula C30H44N2O2 and a molecular weight of 464.69 g/mol. Its IUPAC name is 4-butan-2-yl-2-[2-[(5-butan-2-yl-2-hydroxy-3-propan-2-ylphenyl)methylideneamino]ethyliminomethyl]-6-propan-2-ylphenol.
| Compound Name | 4-butan-2-yl-2-[2-[(5-butan-2-yl-2-hydroxy-3-propan-2-ylphenyl)methylideneamino]ethyliminomethyl]-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 137160061 |
| Molecular Formula | C30H44N2O2 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | 4-butan-2-yl-2-[2-[(5-butan-2-yl-2-hydroxy-3-propan-2-ylphenyl)methylideneamino]ethyliminomethyl]-6-propan-2-ylphenol |
| SMILES | CCC(C)c1cc(/C=N/CC/N=C/c2cc(C(C)CC)cc(C(C)C)c2O)c(O)c(C(C)C)c1 |
| InChI | InChI=1S/C30H44N2O2/c1-9-21(7)23-13-25(29(33)27(15-23)19(3)4)17-31-11-12-32-18-26-14-24(22(8)10-2)16-28(20(5)6)30(26)34/h13-22,33-34H,9-12H2,1-8H3/b31-17+,32-18+ |
| InChIKey | WAEXXEQIOXWZOL-LTTYKRRRSA-N |
| XLogP | 7.91 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|