C23H39NO — CID 162108034
4-(decyliminomethyl)-2,6-di(propan-2-yl)phenol (PubChem CID 162108034) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is 4-(decyliminomethyl)-2,6-di(propan-2-yl)phenol.
| Compound Name | 4-(decyliminomethyl)-2,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 162108034 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | 4-(decyliminomethyl)-2,6-di(propan-2-yl)phenol |
| SMILES | CCCCCCCCCC/N=C/c1cc(C(C)C)c(O)c(C(C)C)c1 |
| InChI | InChI=1S/C23H39NO/c1-6-7-8-9-10-11-12-13-14-24-17-20-15-21(18(2)3)23(25)22(16-20)19(4)5/h15-19,25H,6-14H2,1-5H3/b24-17+ |
| InChIKey | ZFTPPUOJLFIBEQ-JJIBRWJFSA-N |
| XLogP | 7.20 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|