C21H31NO3S — CID 68900701
2-hexylsulfonyl-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile (PubChem CID 68900701) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is 2-hexylsulfonyl-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile.
| Compound Name | 2-hexylsulfonyl-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 68900701 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-hexylsulfonyl-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile |
| SMILES | CCCCCCS(=O)(=O)C(C#N)=Cc1cc(C(C)C)c(O)c(C(C)C)c1 |
| InChI | InChI=1S/C21H31NO3S/c1-6-7-8-9-10-26(24,25)18(14-22)11-17-12-19(15(2)3)21(23)20(13-17)16(4)5/h11-13,15-16,23H,6-10H2,1-5H3 |
| InChIKey | IPVUMXPWTTXWGB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|