C22H23NO4 — CID 11853153
(E)-2-(3,4-dihydroxybenzoyl)-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile (PubChem CID 11853153) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (E)-2-(3,4-dihydroxybenzoyl)-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(3,4-dihydroxybenzoyl)-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11853153 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (E)-2-(3,4-dihydroxybenzoyl)-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enenitrile |
| SMILES | CC(C)c1cc(/C=C(\C#N)C(=O)c2ccc(O)c(O)c2)cc(C(C)C)c1O |
| InChI | InChI=1S/C22H23NO4/c1-12(2)17-8-14(9-18(13(3)4)22(17)27)7-16(11-23)21(26)15-5-6-19(24)20(25)10-15/h5-10,12-13,24-25,27H,1-4H3/b16-7+ |
| InChIKey | QWYDEMBTGBPOFY-FRKPEAEDSA-N |
| XLogP | 4.84 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|