C16H8I2N2O4 — CID 21381583
(E)-3-(4-hydroxy-3,5-diiodophenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile (PubChem CID 21381583) has the molecular formula C16H8I2N2O4 and a molecular weight of 546.06 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-diiodophenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-hydroxy-3,5-diiodophenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21381583 |
| Molecular Formula | C16H8I2N2O4 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 545.86 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-diiodophenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(I)c(O)c(I)c1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H8I2N2O4/c17-13-5-9(6-14(18)16(13)22)4-11(8-19)15(21)10-2-1-3-12(7-10)20(23)24/h1-7,22H/b11-4+ |
| InChIKey | XCBIHDVYHHSRLY-NYYWCZLTSA-N |
| XLogP | 4.30 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|