C24H16FIN2O5 — CID 21381631
(E)-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile (PubChem CID 21381631) has the molecular formula C24H16FIN2O5 and a molecular weight of 558.30 g/mol. Its IUPAC name is (E)-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21381631 |
| Molecular Formula | C24H16FIN2O5 |
| Molecular Weight | 558.30 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | (E)-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)c2cccc([N+](=O)[O-])c2)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C24H16FIN2O5/c1-32-22-11-15(10-21(26)24(22)33-14-17-5-2-3-8-20(17)25)9-18(13-27)23(29)16-6-4-7-19(12-16)28(30)31/h2-12H,14H2,1H3/b18-9+ |
| InChIKey | PDVKAKMMTNYNMR-GIJQJNRQSA-N |
| XLogP | 5.72 |
| TPSA | 102.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.30 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|