C20H13ClN2O5 — CID 21381730
(E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile (PubChem CID 21381730) has the molecular formula C20H13ClN2O5 and a molecular weight of 396.79 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21381730 |
| Molecular Formula | C20H13ClN2O5 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrobenzoyl)prop-2-enenitrile |
| SMILES | C#CCOc1c(Cl)cc(/C=C(\C#N)C(=O)c2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C20H13ClN2O5/c1-3-7-28-20-17(21)9-13(10-18(20)27-2)8-15(12-22)19(24)14-5-4-6-16(11-14)23(25)26/h1,4-6,8-11H,7H2,2H3/b15-8+ |
| InChIKey | RZQIONCKLAJRCX-OVCLIPMQSA-N |
| XLogP | 4.06 |
| TPSA | 102.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|