C25H29NO2S — CID 18185611
S-(3-phenylpropyl) (E)-2-cyano-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enethioate (PubChem CID 18185611) has the molecular formula C25H29NO2S and a molecular weight of 407.58 g/mol. Its IUPAC name is S-(3-phenylpropyl) (E)-2-cyano-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enethioate.
| Compound Name | S-(3-phenylpropyl) (E)-2-cyano-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enethioate |
|---|---|
| PubChem CID | 18185611 |
| Molecular Formula | C25H29NO2S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | S-(3-phenylpropyl) (E)-2-cyano-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enethioate |
| SMILES | CC(C)c1cc(/C=C(\C#N)C(=O)SCCCc2ccccc2)cc(C(C)C)c1O |
| InChI | InChI=1S/C25H29NO2S/c1-17(2)22-14-20(15-23(18(3)4)24(22)27)13-21(16-26)25(28)29-12-8-11-19-9-6-5-7-10-19/h5-7,9-10,13-15,17-18,27H,8,11-12H2,1-4H3/b21-13+ |
| InChIKey | YQTSITJCAKSOOE-FYJGNVAPSA-N |
| XLogP | 6.44 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|