C17H14FNO3S — CID 22000595
(E)-2-(4-fluorophenyl)sulfonyl-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enenitrile (PubChem CID 22000595) has the molecular formula C17H14FNO3S and a molecular weight of 331.37 g/mol. Its IUPAC name is (E)-2-(4-fluorophenyl)sulfonyl-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-fluorophenyl)sulfonyl-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 22000595 |
| Molecular Formula | C17H14FNO3S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (E)-2-(4-fluorophenyl)sulfonyl-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)S(=O)(=O)c2ccc(F)cc2)cc(C)c1O |
| InChI | InChI=1S/C17H14FNO3S/c1-11-7-13(8-12(2)17(11)20)9-16(10-19)23(21,22)15-5-3-14(18)4-6-15/h3-9,20H,1-2H3/b16-9+ |
| InChIKey | NCXZPAKWTRNSHO-CXUHLZMHSA-N |
| XLogP | 3.49 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|