C22H27NO4S — CID 11315592
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(furan-2-ylmethylsulfonyl)prop-2-enenitrile (PubChem CID 11315592) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(furan-2-ylmethylsulfonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(furan-2-ylmethylsulfonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 11315592 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(furan-2-ylmethylsulfonyl)prop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)S(=O)(=O)Cc2ccco2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H27NO4S/c1-21(2,3)18-11-15(12-19(20(18)24)22(4,5)6)10-17(13-23)28(25,26)14-16-8-7-9-27-16/h7-12,24H,14H2,1-6H3/b17-10+ |
| InChIKey | WBOBJRMFQFQPCT-LICLKQGHSA-N |
| XLogP | 5.06 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|