C27H31NO4S — CID 11248298
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2,3-dihydrofuran-2-yl)phenyl]sulfonylprop-2-enenitrile (PubChem CID 11248298) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2,3-dihydrofuran-2-yl)phenyl]sulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2,3-dihydrofuran-2-yl)phenyl]sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 11248298 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2,3-dihydrofuran-2-yl)phenyl]sulfonylprop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)S(=O)(=O)c2ccc(C3CC=CO3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H31NO4S/c1-26(2,3)22-15-18(16-23(25(22)29)27(4,5)6)14-21(17-28)33(30,31)20-11-9-19(10-12-20)24-8-7-13-32-24/h7,9-16,24,29H,8H2,1-6H3/b21-14+ |
| InChIKey | SKIQKRYCDZUYGU-KGENOOAVSA-N |
| XLogP | 6.30 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|