C31H43NO4S — CID 11168464
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylprop-2-enenitrile (PubChem CID 11168464) has the molecular formula C31H43NO4S and a molecular weight of 525.76 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 11168464 |
| Molecular Formula | C31H43NO4S |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylprop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)S(=O)(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H43NO4S/c1-28(2,3)22-14-19(15-23(26(22)33)29(4,5)6)13-21(18-32)37(35,36)20-16-24(30(7,8)9)27(34)25(17-20)31(10,11)12/h13-17,33-34H,1-12H3/b21-13+ |
| InChIKey | COCGQSSXPDWNBN-FYJGNVAPSA-N |
| XLogP | 7.63 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|