C23H34N2O3S — CID 11235464
(E)-2-(azepan-1-ylsulfonyl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 11235464) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is (E)-2-(azepan-1-ylsulfonyl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(azepan-1-ylsulfonyl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 11235464 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (E)-2-(azepan-1-ylsulfonyl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)S(=O)(=O)N2CCCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H34N2O3S/c1-22(2,3)19-14-17(15-20(21(19)26)23(4,5)6)13-18(16-24)29(27,28)25-11-9-7-8-10-12-25/h13-15,26H,7-12H2,1-6H3/b18-13+ |
| InChIKey | IMSIWOLXQUGBDA-QGOAFFKASA-N |
| XLogP | 5.06 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|