C24H29NO4S — CID 87616987
(Z)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-methoxyphenyl)sulfonylprop-2-enenitrile (PubChem CID 87616987) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (Z)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-methoxyphenyl)sulfonylprop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-methoxyphenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 87616987 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (Z)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-methoxyphenyl)sulfonylprop-2-enenitrile |
| SMILES | COc1cccc(S(=O)(=O)/C(C#N)=C\c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H29NO4S/c1-23(2,3)20-12-16(13-21(22(20)26)24(4,5)6)11-19(15-25)30(27,28)18-10-8-9-17(14-18)29-7/h8-14,26H,1-7H3/b19-11- |
| InChIKey | UFSSPMUNYSKZJZ-ODLFYWEKSA-N |
| XLogP | 5.33 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|