C24H27NO5S — CID 11775061
3-[(E)-1-cyano-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]sulfonylbenzoic acid (PubChem CID 11775061) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-[(E)-1-cyano-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]sulfonylbenzoic acid.
| Compound Name | 3-[(E)-1-cyano-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 11775061 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-[(E)-1-cyano-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]sulfonylbenzoic acid |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)S(=O)(=O)c2cccc(C(=O)O)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H27NO5S/c1-23(2,3)19-11-15(12-20(21(19)26)24(4,5)6)10-18(14-25)31(29,30)17-9-7-8-16(13-17)22(27)28/h7-13,26H,1-6H3,(H,27,28)/b18-10+ |
| InChIKey | CDDGKFQBXCUZQA-VCHYOVAHSA-N |
| XLogP | 5.02 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|