C31H31NO3S — CID 72826812
3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2-phenylethynyl)phenyl]sulfonylprop-2-enenitrile (PubChem CID 72826812) has the molecular formula C31H31NO3S and a molecular weight of 497.66 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2-phenylethynyl)phenyl]sulfonylprop-2-enenitrile.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2-phenylethynyl)phenyl]sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 72826812 |
| Molecular Formula | C31H31NO3S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(2-phenylethynyl)phenyl]sulfonylprop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(C=C(C#N)S(=O)(=O)c2ccc(C#Cc3ccccc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H31NO3S/c1-30(2,3)27-19-24(20-28(29(27)33)31(4,5)6)18-26(21-32)36(34,35)25-16-14-23(15-17-25)13-12-22-10-8-7-9-11-22/h7-11,14-20,33H,1-6H3 |
| InChIKey | WLCGRUDVKAMORA-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|