C24H30N2O4S — CID 142966277
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(methoxyamino)phenyl]sulfonylprop-2-enenitrile (PubChem CID 142966277) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(methoxyamino)phenyl]sulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(methoxyamino)phenyl]sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 142966277 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-(methoxyamino)phenyl]sulfonylprop-2-enenitrile |
| SMILES | CONc1ccc(S(=O)(=O)/C(C#N)=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-23(2,3)20-13-16(14-21(22(20)27)24(4,5)6)12-19(15-25)31(28,29)18-10-8-17(9-11-18)26-30-7/h8-14,26-27H,1-7H3/b19-12+ |
| InChIKey | OGLBEJROQCSRKI-XDHOZWIPSA-N |
| XLogP | 5.30 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|