C25H37NO3S — CID 11305008
(E)-2-cyclooctylsulfonyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 11305008) has the molecular formula C25H37NO3S and a molecular weight of 431.64 g/mol. Its IUPAC name is (E)-2-cyclooctylsulfonyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-cyclooctylsulfonyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 11305008 |
| Molecular Formula | C25H37NO3S |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (E)-2-cyclooctylsulfonyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)S(=O)(=O)C2CCCCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H37NO3S/c1-24(2,3)21-15-18(16-22(23(21)27)25(4,5)6)14-20(17-26)30(28,29)19-12-10-8-7-9-11-13-19/h14-16,19,27H,7-13H2,1-6H3/b20-14+ |
| InChIKey | LUMXJGOOVHTUPX-XSFVSMFZSA-N |
| XLogP | 6.38 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|