C29H37NO4S — CID 11752310
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-[(E)-2-(2-methylpropoxy)ethenyl]phenyl]sulfonylprop-2-enenitrile (PubChem CID 11752310) has the molecular formula C29H37NO4S and a molecular weight of 495.69 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-[(E)-2-(2-methylpropoxy)ethenyl]phenyl]sulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-[(E)-2-(2-methylpropoxy)ethenyl]phenyl]sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 11752310 |
| Molecular Formula | C29H37NO4S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[4-[(E)-2-(2-methylpropoxy)ethenyl]phenyl]sulfonylprop-2-enenitrile |
| SMILES | CC(C)CO/C=C/c1ccc(S(=O)(=O)/C(C#N)=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C29H37NO4S/c1-20(2)19-34-14-13-21-9-11-23(12-10-21)35(32,33)24(18-30)15-22-16-25(28(3,4)5)27(31)26(17-22)29(6,7)8/h9-17,20,31H,19H2,1-8H3/b14-13+,24-15+ |
| InChIKey | XCHZCGQBHDISCP-YJEIEFPCSA-N |
| XLogP | 6.97 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|