C10H12Br2 — CID 54340883
1,3-dibromo-5-butan-2-ylbenzene (PubChem CID 54340883) has the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. Its IUPAC name is 1,3-dibromo-5-butan-2-ylbenzene.
| Compound Name | 1,3-dibromo-5-butan-2-ylbenzene |
|---|---|
| PubChem CID | 54340883 |
| Molecular Formula | C10H12Br2 |
| Molecular Weight | 292.01 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 1,3-dibromo-5-butan-2-ylbenzene |
| SMILES | CCC(C)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H12Br2/c1-3-7(2)8-4-9(11)6-10(12)5-8/h4-7H,3H2,1-2H3 |
| InChIKey | XZUGDICXMHMZQZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.01 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |