C10H12Br2O — CID 107978200
1-(3,5-dibromophenyl)butan-1-ol (PubChem CID 107978200) has the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)butan-1-ol.
| Compound Name | 1-(3,5-dibromophenyl)butan-1-ol |
|---|---|
| PubChem CID | 107978200 |
| Molecular Formula | C10H12Br2O |
| Molecular Weight | 308.01 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 1-(3,5-dibromophenyl)butan-1-ol |
| SMILES | CCCC(O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H12Br2O/c1-2-3-10(13)7-4-8(11)6-9(12)5-7/h4-6,10,13H,2-3H2,1H3 |
| InChIKey | LLLAYJWYWHGMGF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.01 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |