C13H18Br2O — CID 107978288
1-(3,5-dibromophenyl)-4,4-dimethylpentan-1-ol (PubChem CID 107978288) has the molecular formula C13H18Br2O and a molecular weight of 350.09 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-4,4-dimethylpentan-1-ol.
| Compound Name | 1-(3,5-dibromophenyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 107978288 |
| Molecular Formula | C13H18Br2O |
| Molecular Weight | 350.09 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 1-(3,5-dibromophenyl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)CCC(O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H18Br2O/c1-13(2,3)5-4-12(16)9-6-10(14)8-11(15)7-9/h6-8,12,16H,4-5H2,1-3H3 |
| InChIKey | DUXZFRWXYAHMDV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.09 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |