C14H21BrO — CID 79437377
2-(4-bromophenyl)-5,5-dimethylhexan-1-ol (PubChem CID 79437377) has the molecular formula C14H21BrO and a molecular weight of 285.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5,5-dimethylhexan-1-ol.
| Compound Name | 2-(4-bromophenyl)-5,5-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 79437377 |
| Molecular Formula | C14H21BrO |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(4-bromophenyl)-5,5-dimethylhexan-1-ol |
| SMILES | CC(C)(C)CCC(CO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H21BrO/c1-14(2,3)9-8-12(10-16)11-4-6-13(15)7-5-11/h4-7,12,16H,8-10H2,1-3H3 |
| InChIKey | RWLXFIARMMCJKU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |