C15H24O — CID 79436768
5,5-dimethyl-2-(4-methylphenyl)hexan-1-ol (PubChem CID 79436768) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 5,5-dimethyl-2-(4-methylphenyl)hexan-1-ol.
| Compound Name | 5,5-dimethyl-2-(4-methylphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 79436768 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 5,5-dimethyl-2-(4-methylphenyl)hexan-1-ol |
| SMILES | Cc1ccc(C(CO)CCC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O/c1-12-5-7-13(8-6-12)14(11-16)9-10-15(2,3)4/h5-8,14,16H,9-11H2,1-4H3 |
| InChIKey | AEKSIVLTYFSWEJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |