C15H23Cl — CID 79435760
1-(1-chloro-5,5-dimethylhexan-2-yl)-4-methylbenzene (PubChem CID 79435760) has the molecular formula C15H23Cl and a molecular weight of 238.80 g/mol. Its IUPAC name is 1-(1-chloro-5,5-dimethylhexan-2-yl)-4-methylbenzene.
| Compound Name | 1-(1-chloro-5,5-dimethylhexan-2-yl)-4-methylbenzene |
|---|---|
| PubChem CID | 79435760 |
| Molecular Formula | C15H23Cl |
| Molecular Weight | 238.80 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-(1-chloro-5,5-dimethylhexan-2-yl)-4-methylbenzene |
| SMILES | Cc1ccc(C(CCl)CCC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23Cl/c1-12-5-7-13(8-6-12)14(11-16)9-10-15(2,3)4/h5-8,14H,9-11H2,1-4H3 |
| InChIKey | KKDWCYLZLKWBBC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.80 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|