C9H10Cl2 — CID 587413
1-(1,2-dichloroethyl)-4-methylbenzene (PubChem CID 587413) has the molecular formula C9H10Cl2 and a molecular weight of 189.08 g/mol. Its IUPAC name is 1-(1,2-dichloroethyl)-4-methylbenzene.
| Compound Name | 1-(1,2-dichloroethyl)-4-methylbenzene |
|---|---|
| PubChem CID | 587413 |
| Molecular Formula | C9H10Cl2 |
| Molecular Weight | 189.08 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 1-(1,2-dichloroethyl)-4-methylbenzene |
| SMILES | Cc1ccc(C(Cl)CCl)cc1 |
| InChI | InChI=1S/C9H10Cl2/c1-7-2-4-8(5-3-7)9(11)6-10/h2-5,9H,6H2,1H3 |
| InChIKey | WAUMFTWHNXCPNG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.08 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|